CymitQuimica logo

CAS 1261365-62-1

:

2,5-Dichloro-6-iodo-3-pyridinol

Description:
2,5-Dichloro-6-iodo-3-pyridinol is a heterocyclic organic compound characterized by its pyridine ring, which is substituted at the 2 and 5 positions with chlorine atoms and at the 6 position with an iodine atom. This compound features a hydroxyl group (-OH) at the 3 position, contributing to its classification as a pyridinol. The presence of halogen substituents, particularly iodine and chlorine, can significantly influence its chemical reactivity, solubility, and potential biological activity. Generally, compounds like this may exhibit antimicrobial or herbicidal properties, making them of interest in agricultural and pharmaceutical applications. The molecular structure suggests that it may participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions, due to the electron-withdrawing nature of the halogens. Additionally, the compound's physical properties, such as melting point and solubility, would depend on the specific arrangement of its substituents and the interactions they promote. Safety and handling precautions should be observed due to the presence of halogens, which can pose health risks.
Formula:C5H2Cl2INO
InChI:InChI=1S/C5H2Cl2INO/c6-2-1-3(10)4(7)9-5(2)8/h1,10H
InChI key:InChIKey=MQVZYFNBLGHQLG-UHFFFAOYSA-N
SMILES:ClC1=C(I)N=C(Cl)C(O)=C1
Synonyms:
  • 2,5-Dichloro-6-iodopyridin-3-ol
  • 2,5-Dichloro-6-iodo-3-pyridinol
  • 3-Pyridinol, 2,5-dichloro-6-iodo-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.