CAS 1261365-65-4
:1,4-Dioxino[2,3-b]pyridin-7-ol, 2,3-dihydro-
Description:
1,4-Dioxino[2,3-b]pyridin-7-ol, 2,3-dihydro- is a heterocyclic organic compound characterized by its unique bicyclic structure that incorporates both a dioxin and a pyridine moiety. This compound features a fused ring system, which contributes to its stability and potential reactivity. The presence of the hydroxyl group (-OH) at the 7-position of the pyridine ring enhances its polarity and solubility in polar solvents, making it suitable for various chemical reactions and applications. Additionally, the dihydro form indicates that the compound has two hydrogen atoms added to the ring structure, which may influence its reactivity and interaction with other chemical species. The compound's specific properties, such as melting point, boiling point, and spectral characteristics, would depend on its molecular structure and functional groups. Due to its unique structure, it may exhibit interesting biological activities, making it a subject of interest in medicinal chemistry and drug development. However, detailed studies would be necessary to fully understand its potential applications and behavior in different environments.
Formula:C7H7NO3
InChI:InChI=1S/C7H7NO3/c9-5-3-6-7(8-4-5)11-2-1-10-6/h3-4,9H,1-2H2
InChI key:InChIKey=SKESGGPLKXRSFG-UHFFFAOYSA-N
SMILES:OC=1C=C2C(=NC1)OCCO2
Synonyms:- 1,4-Dioxino[2,3-b]pyridin-7-ol, 2,3-dihydro-
- 2,3-Dihydro-[1,4]dioxino[2,3-b]pyridin-7-ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
