CAS 1261365-66-5
:3-(Dimethoxymethyl)-1,5-naphthyridine
Description:
3-(Dimethoxymethyl)-1,5-naphthyridine is a chemical compound characterized by its naphthyridine core, which is a bicyclic structure containing nitrogen atoms. This compound features a dimethoxymethyl group, which contributes to its unique reactivity and solubility properties. Typically, naphthyridines exhibit biological activity, making them of interest in medicinal chemistry. The presence of the dimethoxymethyl substituent can enhance lipophilicity and influence the compound's interaction with biological targets. In terms of physical properties, compounds like this may exhibit moderate to high melting points and solubility in organic solvents, depending on the specific functional groups present. The compound's structure suggests potential applications in pharmaceuticals, particularly in the development of new therapeutic agents. Additionally, its synthesis may involve standard organic reactions such as alkylation or methoxylation. As with many nitrogen-containing heterocycles, it may also participate in various chemical reactions, including electrophilic substitutions and coordination with metal ions. Overall, 3-(Dimethoxymethyl)-1,5-naphthyridine represents a versatile scaffold in organic and medicinal chemistry.
Formula:C11H12N2O2
InChI:InChI=1S/C11H12N2O2/c1-14-11(15-2)8-6-10-9(13-7-8)4-3-5-12-10/h3-7,11H,1-2H3
InChI key:InChIKey=VOYWQTGTGIDMGG-UHFFFAOYSA-N
SMILES:C(OC)(OC)C1=CC2=C(N=C1)C=CC=N2
Synonyms:- 1,5-Naphthyridine, 3-(dimethoxymethyl)-
- 3-(Dimethoxymethyl)-1,5-naphthyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.