CAS 1261365-67-6
:5-Bromo-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine-2-carboxaldehyde
Description:
5-Bromo-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine-2-carboxaldehyde is a heterocyclic organic compound characterized by its complex structure, which includes a pyrrolopyridine core, a bromine substituent, and a phenylsulfonyl group. This compound typically exhibits a range of chemical properties due to the presence of functional groups such as the aldehyde and sulfonyl moieties, which can participate in various chemical reactions, including nucleophilic additions and electrophilic substitutions. The bromine atom enhances its reactivity and can serve as a site for further functionalization. Additionally, the compound's structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as the pyrrolopyridine framework is often associated with biological activity. Its solubility and stability in different solvents can vary, influencing its practical applications in synthesis and research. Overall, 5-Bromo-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine-2-carboxaldehyde represents a versatile compound of interest in organic synthesis and drug discovery.
Formula:C14H9BrN2O3S
InChI:InChI=1S/C14H9BrN2O3S/c15-11-6-10-7-12(9-18)17(14(10)16-8-11)21(19,20)13-4-2-1-3-5-13/h1-9H
InChI key:InChIKey=ZJSMGCHOKHJIFB-UHFFFAOYSA-N
SMILES:S(=O)(=O)(N1C=2C(C=C1C=O)=CC(Br)=CN2)C3=CC=CC=C3
Synonyms:- 1H-Pyrrolo[2,3-b]pyridine-2-carboxaldehyde, 5-bromo-1-(phenylsulfonyl)-
- 5-Bromo-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine-2-carboxaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.