CAS 1261365-68-7
:5-(Trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine-4-carboxaldehyde
Description:
5-(Trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine-4-carboxaldehyde is a heterocyclic organic compound characterized by its unique pyrrolopyridine structure, which incorporates a trifluoromethyl group and an aldehyde functional group. The presence of the trifluoromethyl group significantly influences its chemical properties, enhancing lipophilicity and potentially affecting its reactivity and biological activity. The compound features a fused bicyclic system, contributing to its stability and potential applications in medicinal chemistry. As an aldehyde, it can participate in various chemical reactions, including nucleophilic additions and condensation reactions. This compound may exhibit interesting pharmacological properties, making it a candidate for further research in drug development. Its CAS number, 1261365-68-7, allows for precise identification in chemical databases. Overall, the unique structural features and functional groups of this compound suggest potential utility in various chemical and pharmaceutical applications.
Formula:C9H5F3N2O
InChI:InChI=1S/C9H5F3N2O/c10-9(11,12)7-3-14-8-5(1-2-13-8)6(7)4-15/h1-4H,(H,13,14)
InChI key:InChIKey=NZIOEGPYGBYZAP-UHFFFAOYSA-N
SMILES:C(=O)C1=C2C(=NC=C1C(F)(F)F)NC=C2
Synonyms:- 5-(Trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine-4-carboxaldehyde
- 1H-Pyrrolo[2,3-b]pyridine-4-carboxaldehyde, 5-(trifluoromethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.