CAS 1261365-70-1
:5-Fluoro-6-iodo-4-(trimethylsilyl)-1-[tris(1-methylethyl)silyl]-1H-pyrrolo[2,3-b]pyridine
Description:
5-Fluoro-6-iodo-4-(trimethylsilyl)-1-[tris(1-methylethyl)silyl]-1H-pyrrolo[2,3-b]pyridine is a complex organic compound characterized by its unique structural features, which include a pyrrolo[2,3-b]pyridine core substituted with fluorine and iodine atoms, as well as multiple trimethylsilyl groups. The presence of these halogen substituents can influence the compound's reactivity, stability, and potential applications in medicinal chemistry or materials science. The trimethylsilyl groups enhance the compound's solubility and may facilitate various chemical transformations. This compound is likely to exhibit interesting electronic properties due to the presence of the heterocyclic ring and the functional groups attached to it. Additionally, its molecular structure suggests potential uses in drug development or as a precursor in synthetic chemistry. However, specific physical properties such as melting point, boiling point, and solubility would require empirical data for precise characterization. Overall, this compound represents a significant example of functionalized heterocycles in organic synthesis.
Formula:C19H32FIN2Si2
InChI:InChI=1S/C19H32FIN2Si2/c1-12(2)25(13(3)4,14(5)6)23-11-10-15-17(24(7,8)9)16(20)18(21)22-19(15)23/h10-14H,1-9H3
InChI key:InChIKey=YQCMDEMPGXCYPX-UHFFFAOYSA-N
SMILES:[Si](C(C)C)(C(C)C)(C(C)C)N1C=2C(C=C1)=C([Si](C)(C)C)C(F)=C(I)N2
Synonyms:- 1H-Pyrrolo[2,3-b]pyridine, 5-fluoro-6-iodo-4-(trimethylsilyl)-1-[tris(1-methylethyl)silyl]-
- 5-Fluoro-6-iodo-4-(trimethylsilyl)-1-[tris(1-methylethyl)silyl]-1H-pyrrolo[2,3-b]pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.