CAS 1261365-73-4
:4-Iodo-5-(trifluoromethyl)-1-[tris(1-methylethyl)silyl]-1H-pyrrolo[2,3-b]pyridine
Description:
4-Iodo-5-(trifluoromethyl)-1-[tris(1-methylethyl)silyl]-1H-pyrrolo[2,3-b]pyridine is a complex organic compound characterized by its unique structural features, including a pyrrolo[2,3-b]pyridine core, which is a bicyclic heterocyclic structure. The presence of an iodine atom and a trifluoromethyl group contributes to its reactivity and potential applications in medicinal chemistry and material science. The tris(1-methylethyl)silyl group enhances the compound's stability and solubility, making it suitable for various synthetic applications. This compound is likely to exhibit interesting electronic properties due to the electron-withdrawing nature of the trifluoromethyl group and the halogen substituent. Additionally, its silane functionality may facilitate further chemical modifications or polymerization processes. Overall, this compound's unique combination of functional groups and structural characteristics positions it as a valuable candidate for research in organic synthesis and potentially in the development of pharmaceuticals or agrochemicals.
Formula:C17H24F3IN2Si
InChI:InChI=1S/C17H24F3IN2Si/c1-10(2)24(11(3)4,12(5)6)23-8-7-13-15(21)14(17(18,19)20)9-22-16(13)23/h7-12H,1-6H3
InChI key:InChIKey=BNCSOAGCBQPTNQ-UHFFFAOYSA-N
SMILES:[Si](C(C)C)(C(C)C)(C(C)C)N1C=2C(C=C1)=C(I)C(C(F)(F)F)=CN2
Synonyms:- 1H-Pyrrolo[2,3-b]pyridine, 4-iodo-5-(trifluoromethyl)-1-[tris(1-methylethyl)silyl]-
- 4-Iodo-5-(trifluoromethyl)-1-[tris(1-methylethyl)silyl]-1H-pyrrolo[2,3-b]pyridine
- 4-Iodo-5-(trifluoromethyl)-1-(triisopropylsilyl)-1H-pyrrolo[2,3-b]pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.