CAS 1261365-74-5

2-Methyl-6-(trifluoromethyl)-1,8-naphthyridine

Description:

2-Methyl-6-(trifluoromethyl)-1,8-naphthyridine is a heterocyclic organic compound characterized by its naphthyridine structure, which consists of a fused bicyclic system containing nitrogen atoms. The presence of a methyl group at the 2-position and a trifluoromethyl group at the 6-position significantly influences its chemical properties, including its reactivity and polarity. This compound typically exhibits a pale to dark solid appearance and is soluble in organic solvents. Its trifluoromethyl group enhances lipophilicity and can impart unique electronic properties, making it of interest in medicinal chemistry and material science. The nitrogen atoms in the naphthyridine ring contribute to its basicity and potential coordination with metal ions. Additionally, 2-Methyl-6-(trifluoromethyl)-1,8-naphthyridine may exhibit biological activity, which can be explored for pharmaceutical applications. Safety data and handling precautions should be considered, as with any chemical substance, due to potential toxicity or environmental impact.

Formula: C₁₀H₇F₃N₂

InChI: InChI=1S/C10H7F3N2/c1-6-2-3-7-4-8(10(11,12)13)5-14-9(7)15-6/h2-5H,1H3

InChI key: InChIKey=ATPHVXQFNQZKBB-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C1=CC2=C(N=C1)N=C(C)C=C2

Synonyms:

• 1,8-Naphthyridine, 2-methyl-6-(trifluoromethyl)-
• 2-Methyl-6-(trifluoromethyl)-1,8-naphthyridine