CAS 1261365-77-8

3-(Trifluoromethyl)-1,8-naphthyridine

Description:

3-(Trifluoromethyl)-1,8-naphthyridine is a heterocyclic organic compound characterized by the presence of a naphthyridine ring system, which consists of fused pyridine rings. The trifluoromethyl group (-CF3) attached to the third position of the naphthyridine significantly influences its chemical properties, enhancing its lipophilicity and potentially its biological activity. This compound is typically a solid at room temperature and exhibits a relatively high melting point due to the stability of its aromatic structure. The trifluoromethyl group contributes to its electron-withdrawing characteristics, which can affect reactivity in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. Additionally, 3-(Trifluoromethyl)-1,8-naphthyridine may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its unique structure and functional groups can lead to diverse applications in pharmaceuticals, agrochemicals, and materials science. As with many fluorinated compounds, it is important to handle it with care due to potential environmental and health impacts.

Formula: C₉H₅F₃N₂

InChI: InChI=1S/C9H5F3N2/c10-9(11,12)7-4-6-2-1-3-13-8(6)14-5-7/h1-5H

InChI key: InChIKey=CBAVWUUTLLHPHM-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C1=CC2=C(N=C1)N=CC=C2

Synonyms:

• 3-(Trifluoromethyl)-1,8-naphthyridine
• 1,8-Naphthyridine, 3-(trifluoromethyl)-