CymitQuimica logo

CAS 1261365-78-9

:

2-(Dimethoxymethyl)-6-(trifluoromethyl)-1,8-naphthyridine

Description:
2-(Dimethoxymethyl)-6-(trifluoromethyl)-1,8-naphthyridine is a chemical compound characterized by its complex structure, which includes a naphthyridine core substituted with both dimethoxymethyl and trifluoromethyl groups. The presence of the trifluoromethyl group typically enhances the compound's lipophilicity and may influence its biological activity, making it of interest in medicinal chemistry. The dimethoxymethyl substituent can affect the compound's solubility and reactivity, potentially enhancing its stability and interaction with biological targets. This compound may exhibit unique properties such as fluorescence or specific reactivity due to its functional groups. Its applications could range from pharmaceuticals to agrochemicals, depending on its biological activity and interaction with various receptors or enzymes. As with many naphthyridine derivatives, it may also possess antimicrobial or anti-inflammatory properties, warranting further investigation into its potential uses in drug development. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.
Formula:C12H11F3N2O2
InChI:InChI=1S/C12H11F3N2O2/c1-18-11(19-2)9-4-3-7-5-8(12(13,14)15)6-16-10(7)17-9/h3-6,11H,1-2H3
InChI key:InChIKey=ADUYRXAVXAAYSV-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=CC2=C(N=C(C(OC)OC)C=C2)N=C1
Synonyms:
  • 2-(Dimethoxymethyl)-6-(trifluoromethyl)-1,8-naphthyridine
  • 1,8-Naphthyridine, 2-(dimethoxymethyl)-6-(trifluoromethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.