CAS 1261365-80-3
:Methyl 5-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine-4-carboxylate
Description:
Methyl 5-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine-4-carboxylate is a chemical compound characterized by its unique pyrrolopyridine structure, which incorporates a trifluoromethyl group and a carboxylate ester functionality. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to its nitrogen-containing ring system. The trifluoromethyl group enhances lipophilicity and may influence the compound's reactivity and interaction with biological targets. Methyl esters generally have moderate polarity, which can affect solubility in various solvents. The presence of the pyridine moiety suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. Additionally, the compound's structure may allow for various chemical modifications, making it a versatile intermediate in organic synthesis. Overall, Methyl 5-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine-4-carboxylate represents a class of compounds with significant interest in both academic research and industrial applications.
Formula:C10H7F3N2O2
InChI:InChI=1S/C10H7F3N2O2/c1-17-9(16)7-5-2-3-14-8(5)15-4-6(7)10(11,12)13/h2-4H,1H3,(H,14,15)
InChI key:InChIKey=YPPUPUYHVWZLJX-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=C2C(=NC=C1C(F)(F)F)NC=C2
Synonyms:- 1H-Pyrrolo[2,3-b]pyridine-4-carboxylic acid, 5-(trifluoromethyl)-, methyl ester
- Methyl 5-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine-4-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.