CAS 1261365-81-4
:4-Iodo-2,3-dimethoxy-5-(trifluoromethyl)pyridine
Description:
4-Iodo-2,3-dimethoxy-5-(trifluoromethyl)pyridine is a heterocyclic organic compound characterized by the presence of a pyridine ring substituted with various functional groups. The molecule features an iodine atom at the 4-position, which can influence its reactivity and potential applications in synthesis. The 2,3-dimethoxy groups introduce methoxy (-OCH3) substituents that enhance solubility and may affect electronic properties, while the trifluoromethyl (-CF3) group at the 5-position contributes to the compound's lipophilicity and can significantly alter its biological activity. This compound is likely to exhibit interesting chemical behavior due to the combination of electron-withdrawing and electron-donating groups, making it a candidate for various applications in pharmaceuticals, agrochemicals, or materials science. Its unique structure may also provide opportunities for further functionalization or derivatization in synthetic chemistry. As with many halogenated compounds, it is essential to consider safety and environmental implications during handling and disposal.
Formula:C8H7F3INO2
InChI:InChI=1S/C8H7F3INO2/c1-14-6-5(12)4(8(9,10)11)3-13-7(6)15-2/h3H,1-2H3
InChI key:InChIKey=ZFISGSRXCHTAGD-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C=1C(I)=C(OC)C(OC)=NC1
Synonyms:- 4-Iodo-2,3-dimethoxy-5-(trifluoromethyl)pyridine
- Pyridine, 4-iodo-2,3-dimethoxy-5-(trifluoromethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.