CAS 1261365-83-6
:5-Bromo-2-(dimethoxymethyl)-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine
Description:
5-Bromo-2-(dimethoxymethyl)-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine is a synthetic organic compound characterized by its complex molecular structure, which includes a pyrrolopyridine core. The presence of a bromine atom introduces halogen characteristics, potentially enhancing reactivity and influencing the compound's electronic properties. The dimethoxymethyl group contributes to the compound's solubility and steric properties, while the phenylsulfonyl moiety can enhance its pharmacological profile, often associated with increased bioactivity. This compound may exhibit interesting biological activities, making it a candidate for pharmaceutical research. Its unique structure allows for potential interactions with biological targets, which can be explored in medicinal chemistry. Additionally, the compound's stability, solubility, and reactivity can be influenced by the functional groups present, making it a subject of interest in both synthetic and medicinal chemistry. As with many such compounds, safety and handling precautions should be observed due to potential toxicity or reactivity associated with its chemical structure.
Formula:C16H15BrN2O4S
InChI:InChI=1S/C16H15BrN2O4S/c1-22-16(23-2)14-9-11-8-12(17)10-18-15(11)19(14)24(20,21)13-6-4-3-5-7-13/h3-10,16H,1-2H3
InChI key:InChIKey=PBHHJQYSEQTYRY-UHFFFAOYSA-N
SMILES:S(=O)(=O)(N1C(C(OC)OC)=CC=2C1=NC=C(Br)C2)C3=CC=CC=C3
Synonyms:- 5-Bromo-2-(dimethoxymethyl)-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine
- 1H-Pyrrolo[2,3-b]pyridine, 5-bromo-2-(dimethoxymethyl)-1-(phenylsulfonyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.