CymitQuimica logo

CAS 1261365-87-0

:

5-Chloro-3-iodo-2-pyridinyl 1,1,1-trifluoromethanesulfonate

Description:
5-Chloro-3-iodo-2-pyridinyl 1,1,1-trifluoromethanesulfonate is a chemical compound characterized by its complex structure, which includes a pyridine ring substituted with chlorine and iodine atoms, as well as a trifluoromethanesulfonate group. This compound is typically used in organic synthesis and may serve as a reagent in various chemical reactions, particularly in the formation of carbon-fluorine bonds. The presence of the trifluoromethanesulfonate moiety suggests that it may exhibit good leaving group properties, making it useful in nucleophilic substitution reactions. Additionally, the halogen substituents (chlorine and iodine) can influence the reactivity and selectivity of the compound in synthetic applications. Its unique combination of functional groups may also impart specific physical and chemical properties, such as solubility in polar solvents and potential biological activity. Safety precautions should be taken when handling this compound, as it may pose health risks due to its halogenated nature and potential reactivity.
Formula:C6H2ClF3INO3S
InChI:InChI=1S/C6H2ClF3INO3S/c7-3-1-4(11)5(12-2-3)15-16(13,14)6(8,9)10/h1-2H
InChI key:InChIKey=IRCLLYHKRRFPRN-UHFFFAOYSA-N
SMILES:O(S(C(F)(F)F)(=O)=O)C1=C(I)C=C(Cl)C=N1
Synonyms:
  • Methanesulfonic acid, 1,1,1-trifluoro-, 5-chloro-3-iodo-2-pyridinyl ester
  • 5-Chloro-3-iodo-2-pyridinyl 1,1,1-trifluoromethanesulfonate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.