CymitQuimica logo

CAS 1261365-88-1

:

4-Iodo-3-methoxy-1,5-naphthyridine

Description:
4-Iodo-3-methoxy-1,5-naphthyridine is a heterocyclic organic compound characterized by the presence of a naphthyridine core, which consists of a fused bicyclic structure containing nitrogen atoms. The compound features an iodine atom at the 4-position and a methoxy group (-OCH3) at the 3-position of the naphthyridine ring. This substitution pattern can influence its chemical reactivity, solubility, and biological activity. The presence of the iodine atom may enhance the compound's lipophilicity and potential for interactions in biological systems, while the methoxy group can serve as an electron-donating substituent, affecting the electronic properties of the molecule. 4-Iodo-3-methoxy-1,5-naphthyridine may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its synthesis typically involves multi-step organic reactions, and it can be analyzed using techniques such as NMR spectroscopy and mass spectrometry to confirm its structure and purity. Overall, this compound represents a valuable scaffold for further research and development in various chemical and pharmaceutical applications.
Formula:C9H7IN2O
InChI:InChI=1S/C9H7IN2O/c1-13-7-5-12-6-3-2-4-11-9(6)8(7)10/h2-5H,1H3
InChI key:InChIKey=KULFYCCJHFTAJE-UHFFFAOYSA-N
SMILES:IC=1C2=C(N=CC1OC)C=CC=N2
Synonyms:
  • 4-Iodo-3-methoxy-1,5-naphthyridine
  • 1,5-Naphthyridine, 4-iodo-3-methoxy-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.