CAS 1261365-92-7

5-Chloro-4-(dimethoxymethyl)-1H-pyrrolo[2,3-b]pyridine

Description:

5-Chloro-4-(dimethoxymethyl)-1H-pyrrolo[2,3-b]pyridine is a heterocyclic organic compound characterized by its pyrrolopyridine structure, which consists of a fused pyrrole and pyridine ring system. The presence of a chlorine atom at the 5-position and two methoxy groups at the 4-position contributes to its unique chemical properties and potential reactivity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents due to its polar functional groups. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as the pyrrolopyridine framework is often associated with biological activity. The dimethoxymethyl substituents may enhance lipophilicity and influence the compound's interaction with biological targets. Additionally, the chlorine atom can participate in various chemical reactions, making this compound a versatile intermediate in synthetic organic chemistry. As with many heterocycles, it may also exhibit interesting electronic properties, which could be explored in materials science or as a ligand in coordination chemistry.

Formula: C₁₀H₁₁ClN₂O₂

InChI: InChI=1S/C10H11ClN2O2/c1-14-10(15-2)8-6-3-4-12-9(6)13-5-7(8)11/h3-5,10H,1-2H3,(H,12,13)

InChI key: InChIKey=WVGJKUQSSTUXRQ-UHFFFAOYSA-N

SMILES: C(OC)(OC)C1=C2C(=NC=C1Cl)NC=C2

Synonyms:

• 1H-Pyrrolo[2,3-b]pyridine, 5-chloro-4-(dimethoxymethyl)-
• 5-Chloro-4-(dimethoxymethyl)-1H-pyrrolo[2,3-b]pyridine