CymitQuimica logo

CAS 1261365-93-8

:

1-[6-(Dimethoxymethyl)-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-1-yl]-2,2-dimethyl-1-propanone

Description:
1-[6-(Dimethoxymethyl)-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-1-yl]-2,2-dimethyl-1-propanone, with CAS number 1261365-93-8, is a synthetic organic compound characterized by its complex molecular structure, which includes a pyrido[2,3-b][1,4]oxazine core. This compound features a dimethoxymethyl substituent that enhances its solubility and reactivity. The presence of a ketone functional group (propanone) suggests potential reactivity in nucleophilic addition reactions. The compound is likely to exhibit moderate to high polarity due to the presence of multiple functional groups, which may influence its solubility in various solvents. Additionally, the structural features may impart biological activity, making it of interest in medicinal chemistry. Its synthesis and characterization would typically involve techniques such as NMR spectroscopy, mass spectrometry, and chromatography to confirm purity and structural integrity. As with many organic compounds, safety data sheets should be consulted for handling and storage guidelines, as well as potential hazards associated with its use.
Formula:C15H22N2O4
InChI:InChI=1S/C15H22N2O4/c1-15(2,3)14(18)17-8-9-21-12-11(17)7-6-10(16-12)13(19-4)20-5/h6-7,13H,8-9H2,1-5H3
InChI key:InChIKey=JQCZZVJXSXSWHP-UHFFFAOYSA-N
SMILES:C(C(C)(C)C)(=O)N1C=2C(=NC(C(OC)OC)=CC2)OCC1
Synonyms:
  • 1-Propanone, 1-[6-(dimethoxymethyl)-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-1-yl]-2,2-dimethyl-
  • 1-[6-(Dimethoxymethyl)-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-1-yl]-2,2-dimethyl-1-propanone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.