CymitQuimica logo

CAS 1261365-94-9

:

7-(Dimethoxymethyl)-2,3-dihydro-1,4-dioxino[2,3-b]pyridine

Description:
7-(Dimethoxymethyl)-2,3-dihydro-1,4-dioxino[2,3-b]pyridine is a heterocyclic organic compound characterized by its unique bicyclic structure, which includes a pyridine ring fused with a dioxin moiety. This compound features a dimethoxymethyl substituent, which contributes to its chemical reactivity and solubility properties. The presence of the dioxin ring imparts potential biological activity, making it of interest in medicinal chemistry. Its molecular structure suggests that it may exhibit properties such as moderate polarity, which can influence its interactions with biological targets. The compound's synthesis typically involves multi-step organic reactions, and it may be analyzed using techniques such as NMR spectroscopy, mass spectrometry, and chromatography to confirm its identity and purity. Additionally, the compound's potential applications could span pharmaceuticals, agrochemicals, or materials science, depending on its specific biological or chemical properties. As with any chemical substance, safety data and handling precautions should be reviewed before use.
Formula:C10H13NO4
InChI:InChI=1S/C10H13NO4/c1-12-10(13-2)7-5-8-9(11-6-7)15-4-3-14-8/h5-6,10H,3-4H2,1-2H3
InChI key:InChIKey=JXCKHIXCZFWYSD-UHFFFAOYSA-N
SMILES:C(OC)(OC)C=1C=C2C(=NC1)OCCO2
Synonyms:
  • 1,4-Dioxino[2,3-b]pyridine, 7-(dimethoxymethyl)-2,3-dihydro-
  • 7-(Dimethoxymethyl)-2,3-dihydro-1,4-dioxino[2,3-b]pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.