CymitQuimica logo

CAS 1261448-86-5

:

2-(2,3-Difluorophenyl)-5-methyl-3-pyridinol

Description:
2-(2,3-Difluorophenyl)-5-methyl-3-pyridinol is a chemical compound characterized by its unique molecular structure, which includes a pyridine ring substituted with a methyl group and a difluorophenyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including potential biological activity due to the presence of the pyridine moiety. The difluorophenyl group can influence the compound's electronic properties and reactivity, potentially enhancing its lipophilicity and affecting its interaction with biological targets. The presence of fluorine atoms often contributes to increased metabolic stability and altered pharmacokinetics. In terms of solubility, compounds of this nature may exhibit moderate solubility in organic solvents, while their solubility in water can vary depending on the specific functional groups present. Overall, 2-(2,3-Difluorophenyl)-5-methyl-3-pyridinol is of interest in medicinal chemistry and may be explored for its potential applications in pharmaceuticals or agrochemicals.
Formula:C12H9F2NO
InChI:InChI=1S/C12H9F2NO/c1-7-5-10(16)12(15-6-7)8-3-2-4-9(13)11(8)14/h2-6,16H,1H3
InChI key:InChIKey=NOFSWMCODGCZCA-UHFFFAOYSA-N
SMILES:OC1=C(N=CC(C)=C1)C2=C(F)C(F)=CC=C2
Synonyms:
  • 3-Pyridinol, 2-(2,3-difluorophenyl)-5-methyl-
  • 2-(2,3-Difluorophenyl)-5-methyl-3-pyridinol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.