
CAS 1261453-95-5
:1-Fluoro-2-naphthalenemethanamine
Description:
1-Fluoro-2-naphthalenemethanamine is an organic compound characterized by the presence of a fluorine atom and an amine functional group attached to a naphthalene ring system. The compound features a naphthalene backbone, which consists of two fused aromatic rings, contributing to its stability and hydrophobic characteristics. The fluorine substituent enhances the compound's reactivity and can influence its electronic properties, making it potentially useful in various chemical reactions and applications. The amine group introduces basicity and nucleophilicity, allowing for interactions with electrophiles. This compound may exhibit interesting biological activities, making it a candidate for pharmaceutical research. Its molecular structure suggests potential applications in organic synthesis, materials science, and medicinal chemistry. As with many fluorinated compounds, it may also possess unique properties such as increased lipophilicity and altered metabolic pathways. Safety and handling precautions should be observed due to the potential toxicity associated with amines and fluorinated compounds.
Formula:C11H10FN
InChI:InChI=1S/C11H10FN/c12-11-9(7-13)6-5-8-3-1-2-4-10(8)11/h1-6H,7,13H2
InChI key:InChIKey=ZWECIOAMZLEDKX-UHFFFAOYSA-N
SMILES:FC=1C2=C(C=CC1CN)C=CC=C2
Synonyms:- 1-Fluoro-2-naphthalenemethanamine
- 2-Naphthalenemethanamine, 1-fluoro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.