
CAS 1261455-22-4
:2-Hydroxy-6-(trifluoromethoxy)benzamide
Description:
2-Hydroxy-6-(trifluoromethoxy)benzamide is an organic compound characterized by the presence of a hydroxyl group (-OH) and a trifluoromethoxy group (-O-CF3) attached to a benzamide structure. This compound features a benzene ring with a carbonyl group (C=O) linked to an amine (NH2), which is typical of amides. The trifluoromethoxy group significantly influences the compound's electronic properties, enhancing its lipophilicity and potentially affecting its reactivity and biological activity. The hydroxyl group can participate in hydrogen bonding, which may enhance solubility in polar solvents. The presence of fluorine atoms in the trifluoromethoxy group can also impart unique characteristics, such as increased stability and altered interaction with biological targets. This compound may be of interest in medicinal chemistry and materials science due to its potential applications in drug development and as a building block for more complex molecules. Overall, the combination of functional groups in 2-Hydroxy-6-(trifluoromethoxy)benzamide suggests a versatile compound with potential utility in various chemical and pharmaceutical contexts.
Formula:C8H6F3NO3
InChI:InChI=1S/C8H6F3NO3/c9-8(10,11)15-5-3-1-2-4(13)6(5)7(12)14/h1-3,13H,(H2,12,14)
InChI key:InChIKey=MEVYSRBOFHNZSW-UHFFFAOYSA-N
SMILES:C(N)(=O)C1=C(OC(F)(F)F)C=CC=C1O
Synonyms:- Benzamide, 2-hydroxy-6-(trifluoromethoxy)-
- 2-Hydroxy-6-(trifluoromethoxy)benzamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.