
CAS 1261471-97-9
:2-Bromo-3-(trifluoromethoxy)pyrazine
Description:
2-Bromo-3-(trifluoromethoxy)pyrazine is a heterocyclic organic compound characterized by the presence of a pyrazine ring, which is a six-membered aromatic ring containing two nitrogen atoms. The compound features a bromine atom at the 2-position and a trifluoromethoxy group (-OCF3) at the 3-position of the pyrazine ring, contributing to its unique chemical properties. The trifluoromethoxy group enhances the compound's lipophilicity and may influence its reactivity and interaction with biological systems. This compound is typically used in synthetic organic chemistry and may serve as an intermediate in the synthesis of pharmaceuticals or agrochemicals. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of compounds with specific biological activities. Additionally, the presence of both bromine and trifluoromethoxy groups may impart distinctive electronic properties, making it a subject of interest in materials science and chemical research. Safety data should be consulted for handling and storage, as halogenated compounds can exhibit varying degrees of toxicity and environmental impact.
Formula:C5H2BrF3N2O
InChI:InChI=1S/C5H2BrF3N2O/c6-3-4(11-2-1-10-3)12-5(7,8)9/h1-2H
InChI key:InChIKey=WPDYHQBFAMMNHL-UHFFFAOYSA-N
SMILES:O(C(F)(F)F)C=1C(Br)=NC=CN1
Synonyms:- Pyrazine, 2-bromo-3-(trifluoromethoxy)-
- 2-Bromo-3-(trifluoromethoxy)pyrazine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.