CAS 1261473-37-3

Methyl 4-bromo-2-methyl-6-quinolinecarboxylate

Description:

Methyl 4-bromo-2-methyl-6-quinolinecarboxylate is an organic compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom in the ring. This substance features a bromine atom at the 4-position and a methyl group at the 2-position of the quinoline ring, along with a carboxylate ester functional group. The presence of the bromine substituent typically enhances the compound's reactivity, making it useful in various synthetic applications, including medicinal chemistry and material science. The methyl ester group contributes to its solubility in organic solvents and can be hydrolyzed to yield the corresponding carboxylic acid. This compound may exhibit biological activity, potentially serving as a scaffold for drug development. Its unique structure and functional groups suggest potential applications in the synthesis of more complex molecules, as well as in the study of quinoline derivatives in pharmacology. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity and reactivity.

Formula: C₁₂H₁₀BrNO₂

InChI: InChI=1S/C12H10BrNO2/c1-7-5-10(13)9-6-8(12(15)16-2)3-4-11(9)14-7/h3-6H,1-2H3

InChI key: InChIKey=JPRUJIDBEPFVGX-UHFFFAOYSA-N

SMILES: BrC=1C2=C(C=CC(C(OC)=O)=C2)N=C(C)C1

Synonyms:

• 6-Quinolinecarboxylic acid, 4-bromo-2-methyl-, methyl ester
• Methyl 4-bromo-2-methyl-6-quinolinecarboxylate