CymitQuimica logo

CAS 1261479-05-3

:

2-Bromo-1-(2,6-dibromophenyl)-1-propanone

Description:
2-Bromo-1-(2,6-dibromophenyl)-1-propanone is an organic compound characterized by its brominated aromatic structure and ketone functional group. It features a propanone backbone with a bromine atom attached to the first carbon and a 2,6-dibromophenyl group at the second carbon. This compound is typically a solid at room temperature and exhibits a relatively high melting point due to the presence of multiple bromine substituents, which increase molecular weight and intermolecular interactions. The bromine atoms contribute to its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the presence of the ketone functional group suggests that it may participate in reactions typical of carbonyl compounds, such as aldol condensation or reduction. Its unique structure may also impart specific properties, such as increased lipophilicity and potential biological activity, making it of interest in medicinal chemistry and material science. Safety precautions should be taken when handling this compound due to the toxicity associated with brominated compounds.
Formula:C9H7Br3O
InChI:InChI=1S/C9H7Br3O/c1-5(10)9(13)8-6(11)3-2-4-7(8)12/h2-5H,1H3
InChI key:InChIKey=POFGYUBJUXRKLT-UHFFFAOYSA-N
SMILES:C(C(Br)C)(=O)C1=C(Br)C=CC=C1Br
Synonyms:
  • 2-Bromo-1-(2,6-dibromophenyl)-1-propanone
  • 1-Propanone, 2-bromo-1-(2,6-dibromophenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.