CAS 1261480-93-6

3-(Chloromethyl)-2-nitrophenol

Description:

3-(Chloromethyl)-2-nitrophenol is an organic compound characterized by the presence of a chloromethyl group and a nitro group attached to a phenolic ring. Its molecular structure features a phenol backbone, which contributes to its reactivity and potential applications in various chemical processes. The chloromethyl group enhances its electrophilic properties, making it useful in nucleophilic substitution reactions. The nitro group, known for its electron-withdrawing effects, can influence the compound's acidity and reactivity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. It is important to handle it with care due to potential toxicity and environmental concerns associated with nitro compounds. Applications may include use in organic synthesis, as an intermediate in the production of dyes, pharmaceuticals, or agrochemicals. As with any chemical substance, proper safety protocols should be followed when handling 3-(Chloromethyl)-2-nitrophenol to mitigate risks associated with exposure.

Formula: C₇H₆ClNO₃

InChI: InChI=1S/C7H6ClNO3/c8-4-5-2-1-3-6(10)7(5)9(11)12/h1-3,10H,4H2

InChI key: InChIKey=SHKMIKFIGUUQRO-UHFFFAOYSA-N

SMILES: N(=O)(=O)C1=C(CCl)C=CC=C1O

Synonyms:

• 3-(Chloromethyl)-2-nitrophenol
• Phenol, 3-(chloromethyl)-2-nitro-