
CAS 1261488-19-0
:3-(Difluoromethoxy)-2-naphthalenemethanol
Description:
3-(Difluoromethoxy)-2-naphthalenemethanol is a chemical compound characterized by its unique structure, which includes a naphthalene ring system substituted with a difluoromethoxy group and a hydroxymethyl group. This compound is notable for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to the presence of the naphthalene moiety, which is often associated with biological activity. The difluoromethoxy group enhances the compound's lipophilicity and may influence its interaction with biological targets. Additionally, the hydroxymethyl group can participate in hydrogen bonding, which may affect the compound's solubility and reactivity. The presence of fluorine atoms typically imparts unique electronic properties, potentially enhancing the compound's stability and reactivity. Overall, 3-(Difluoromethoxy)-2-naphthalenemethanol represents a class of compounds that may exhibit interesting chemical behavior and biological activity, making it a subject of interest in research and development within the fields of organic and medicinal chemistry.
Formula:C12H10F2O2
InChI:InChI=1S/C12H10F2O2/c13-12(14)16-11-6-9-4-2-1-3-8(9)5-10(11)7-15/h1-6,12,15H,7H2
InChI key:InChIKey=GFGZSXZGGFKCJH-UHFFFAOYSA-N
SMILES:O(C(F)F)C1=CC2=C(C=C1CO)C=CC=C2
Synonyms:- 2-Naphthalenemethanol, 3-(difluoromethoxy)-
- 3-(Difluoromethoxy)-2-naphthalenemethanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.