CAS 1261488-24-7

3-Chloro-4-methoxy-5-methylpyridine

Description:

3-Chloro-4-methoxy-5-methylpyridine is a heterocyclic organic compound characterized by a pyridine ring substituted with a chlorine atom, a methoxy group, and a methyl group. The presence of these substituents influences its chemical properties, making it a polar compound with potential applications in pharmaceuticals and agrochemicals. The chlorine atom introduces electrophilic characteristics, while the methoxy group can enhance solubility and reactivity. The methyl group contributes to the overall hydrophobicity of the molecule. This compound is typically synthesized through specific reactions involving pyridine derivatives and can be analyzed using techniques such as NMR and mass spectrometry to confirm its structure. Its unique combination of functional groups may impart biological activity, making it of interest in medicinal chemistry. Additionally, the compound's stability and reactivity can be influenced by environmental factors, which is crucial for its application in various chemical processes. Overall, 3-Chloro-4-methoxy-5-methylpyridine is a versatile compound with significant potential in various chemical and industrial applications.

Formula: C₇H₈ClNO

InChI: InChI=1S/C7H8ClNO/c1-5-3-9-4-6(8)7(5)10-2/h3-4H,1-2H3

InChI key: InChIKey=UGGMXZJKCGYAIT-UHFFFAOYSA-N

SMILES: O(C)C=1C(C)=CN=CC1Cl

Synonyms:

• Pyridine, 3-chloro-4-methoxy-5-methyl-
• 3-Chloro-4-methoxy-5-methylpyridine