CAS 126149-77-7

1H-Pyrrolo[2,3-d]pyrimidine-5-carboxylicacid,4-amino-,methylester(9CI)

Description:

1H-Pyrrolo[2,3-d]pyrimidine-5-carboxylic acid, 4-amino-, methyl ester (CAS 126149-77-7) is a heterocyclic organic compound characterized by its pyrrolopyrimidine structure, which consists of a fused pyrrole and pyrimidine ring system. This compound features a carboxylic acid functional group and an amino group, contributing to its potential biological activity. The methyl ester form indicates that the carboxylic acid is esterified with methanol, enhancing its solubility and reactivity. Typically, such compounds exhibit a range of pharmacological properties, making them of interest in medicinal chemistry and drug development. The presence of both amino and carboxylic acid functionalities suggests potential for hydrogen bonding and interactions with biological targets. Additionally, the compound may participate in various chemical reactions, including esterification and nucleophilic substitutions, which are relevant in synthetic organic chemistry. Overall, its unique structure and functional groups position it as a valuable compound for further research and application in pharmaceuticals and related fields.

Formula: C₈H₈N₄O₂

InChI: InChI=1/C8H8N4O2/c1-14-8(13)4-2-10-7-5(4)6(9)11-3-12-7/h2-3H,1H3,(H3,9,10,11,12)

SMILES: COC(=O)c1cnc2c1c(N)nc[nH]2

Synonyms:

• Methyl 4-amino-7H-pyrrolo[2,3-d]pyrimidine-5-carboxylate

Methyl 4-amino-7H-pyrrolo[2,3-d]pyrimidine-5-carboxylate

CAS: 126149-77-7

Formula: C₈H₈N₄O₂

Molecular weight: 192.1747

Ref: IN-DA000RT1