CAS 1261491-89-7: 2-[(2-Ethoxy-2-oxoethyl)methylamino]-2-oxoethyl 5-(tetradecyloxy)-2-furancarboxylate
Description:2-[(2-Ethoxy-2-oxoethyl)methylamino]-2-oxoethyl 5-(tetradecyloxy)-2-furancarboxylate is a complex organic compound characterized by its unique structural features, which include a furan ring, an ethoxy group, and a tetradecyloxy chain. This compound is likely to exhibit properties typical of esters and amines, such as moderate solubility in organic solvents and potential reactivity due to the presence of functional groups. The furan moiety may contribute to its aromatic characteristics, while the long tetradecyloxy chain suggests potential surfactant properties, enhancing its solubility in lipid environments. The presence of the ethoxy and oxoethyl groups indicates that it may participate in hydrogen bonding, influencing its physical properties like boiling and melting points. Additionally, the compound may have applications in fields such as pharmaceuticals or materials science, owing to its complex structure and potential biological activity. However, specific data regarding its toxicity, stability, and reactivity would require further investigation and characterization through experimental studies.
Formula:C26H43NO7
InChI:InChI=1S/C26H43NO7/c1-4-6-7-8-9-10-11-12-13-14-15-16-19-32-25-18-17-22(34-25)26(30)33-21-23(28)27(3)20-24(29)31-5-2/h17-18H,4-16,19-21H2,1-3H3
InChI key:InChIKey=FYJLDICZGDFWKP-UHFFFAOYSA-N
SMILES:O=C(OCC(=O)N(C)CC(=O)OCC)C=1OC(OCCCCCCCCCCCCCC)=CC1
- Synonyms:
- DRM 01B
- 2-[(2-ethoxy-2-oxoethyl)methylamino]-2-oxoethyl 5-(tetradecyloxy)furan-2-carboxylate
- 2-Furancarboxylic acid, 5-(tetradecyloxy)-, 2-[(2-ethoxy-2-oxoethyl)methylamino]-2-oxoethyl ester
- 2-[(2-Ethoxy-2-oxoethyl)methylamino]-2-oxoethyl 5-(tetradecyloxy)-2-furancarboxylate
- Olumacostat glasaretil
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | Olumacostat Glasaretil REF: TM-T3510CAS: 1261491-89-7 | 97.79% - 99.34% | 55.00 €~943.00 € | Tue 22 Apr 25 |
![]() | Olumacostat glasaretil REF: 3D-LAC49189CAS: 1261491-89-7 | Min. 95% | - - - | Discontinued product |

Olumacostat Glasaretil
Ref: TM-T3510
1mg | 55.00 € | ||
2mg | 66.00 € | ||
5mg | 96.00 € | ||
10mg | 144.00 € | ||
25mg | 265.00 € | ||
50mg | 454.00 € | ||
100mg | 662.00 € | ||
200mg | 943.00 € | ||
1mL*10mM (DMSO) | 97.00 € |

Olumacostat glasaretil
Ref: 3D-LAC49189
25mg | Discontinued | Request information | |
50mg | Discontinued | Request information | |
100mg | Discontinued | Request information |