
CAS 1261492-01-6
:5-Chloro-2′-(trifluoromethyl)[1,1′-biphenyl]-3-ol
Description:
5-Chloro-2′-(trifluoromethyl)[1,1′-biphenyl]-3-ol is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a chloro group at the 5-position and a trifluoromethyl group at the 2′-position significantly influences its chemical properties, including its reactivity and polarity. The hydroxyl (-OH) group at the 3-position contributes to its potential as a phenolic compound, which can engage in hydrogen bonding and exhibit acidic behavior. This compound is likely to be a solid at room temperature, with moderate solubility in organic solvents due to its hydrophobic biphenyl framework and polar hydroxyl group. Its unique functional groups suggest potential applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. Additionally, the trifluoromethyl group often enhances biological activity and lipophilicity, making this compound of interest in medicinal chemistry. Safety and handling precautions should be observed due to the presence of chlorine and fluorine atoms, which can pose environmental and health risks.
Formula:C13H8ClF3O
InChI:InChI=1S/C13H8ClF3O/c14-9-5-8(6-10(18)7-9)11-3-1-2-4-12(11)13(15,16)17/h1-7,18H
InChI key:InChIKey=GVWVFKNBMPHVQV-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=C(C=CC=C1)C2=CC(Cl)=CC(O)=C2
Synonyms:- 5-Chloro-2′-(trifluoromethyl)[1,1′-biphenyl]-3-ol
- [1,1′-Biphenyl]-3-ol, 5-chloro-2′-(trifluoromethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.