CAS 1261497-16-8

5-[4-(Trifluoromethyl)phenyl]-3-pyridinol

Description:

5-[4-(Trifluoromethyl)phenyl]-3-pyridinol, with the CAS number 1261497-16-8, is an organic compound characterized by its pyridine and phenyl functional groups. The presence of a trifluoromethyl group (-CF3) on the phenyl ring significantly influences its chemical properties, enhancing lipophilicity and potentially affecting its biological activity. This compound typically exhibits a solid-state at room temperature and is soluble in organic solvents, reflecting its non-polar characteristics due to the trifluoromethyl substitution. The pyridinol moiety contributes to its potential as a ligand in coordination chemistry or as an intermediate in organic synthesis. Additionally, the compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its stability and reactivity can be influenced by the electron-withdrawing nature of the trifluoromethyl group, which can affect its interaction with other chemical species. Overall, 5-[4-(Trifluoromethyl)phenyl]-3-pyridinol is a versatile compound with potential applications in various fields, including pharmaceuticals and materials science.

Formula: C₁₂H₈F₃NO

InChI: InChI=1S/C12H8F3NO/c13-12(14,15)10-3-1-8(2-4-10)9-5-11(17)7-16-6-9/h1-7,17H

InChI key: InChIKey=PFXPRLOVDAIVHA-UHFFFAOYSA-N

SMILES: OC1=CC(=CN=C1)C2=CC=C(C(F)(F)F)C=C2

Synonyms:

• 3-Pyridinol, 5-[4-(trifluoromethyl)phenyl]-
• 5-[4-(Trifluoromethyl)phenyl]-3-pyridinol