CAS 1261498-28-5

3-Amino-2-nitrobenzenemethanamine

Description:

3-Amino-2-nitrobenzenemethanamine, identified by its CAS number 1261498-28-5, is an organic compound characterized by the presence of both amino and nitro functional groups attached to a benzene ring. This compound features a methanamine group, which contributes to its basicity and potential reactivity. The amino group (-NH2) typically imparts properties such as increased solubility in water and the ability to participate in various chemical reactions, including nucleophilic substitutions. The nitro group (-NO2) is known for its electron-withdrawing effects, which can influence the compound's reactivity and stability. This compound may be used in various applications, including as an intermediate in organic synthesis or in the development of pharmaceuticals. Its specific physical and chemical properties, such as melting point, boiling point, and solubility, would depend on the molecular structure and interactions of the functional groups present. Safety data should be consulted for handling and usage, as compounds with nitro and amino groups can exhibit varying degrees of toxicity and reactivity.

Formula: C₇H₉N₃O₂

InChI: InChI=1S/C7H9N3O2/c8-4-5-2-1-3-6(9)7(5)10(11)12/h1-3H,4,8-9H2

InChI key: InChIKey=HFSXDOBHVWOQFE-UHFFFAOYSA-N

SMILES: N(=O)(=O)C1=C(CN)C=CC=C1N

Synonyms:

• Benzenemethanamine, 3-amino-2-nitro-
• 3-Amino-2-nitrobenzenemethanamine