CAS 1261498-41-2: 3-(Difluoromethoxy)-2-fluorobenzenamine

Description: 3-(Difluoromethoxy)-2-fluorobenzenamine is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with both fluorine and difluoromethoxy groups. The presence of multiple fluorine atoms contributes to its unique chemical properties, such as increased lipophilicity and potential bioactivity. The difluoromethoxy group enhances the compound's stability and may influence its reactivity, making it of interest in medicinal chemistry and material science. This compound is likely to exhibit polar characteristics due to the electronegative fluorine atoms, which can affect its solubility in various solvents. Additionally, the amine functional group can participate in hydrogen bonding, impacting its interactions with biological targets. Overall, 3-(Difluoromethoxy)-2-fluorobenzenamine is a fluorinated aromatic amine that may have applications in pharmaceuticals or agrochemicals, although specific biological activities and applications would require further investigation.

Formula: C₇H₆F₃NO

InChI: InChI=1S/C7H6F3NO/c8-6-4(11)2-1-3-5(6)12-7(9)10/h1-3,7H,11H2

InChI key: InChIKey=CZRZXNSXNQBBCM-UHFFFAOYSA-N

SMILES: FC=1C(OC(F)F)=CC=CC1N

3-(Difluoromethoxy)-2-fluoroaniline

CAS: 1261498-41-2

• Color and Shape: Liquid
• Molecular weight: 177.12g/mol

3-(DIFLUOROMETHOXY)-2-FLUOROANILINE

CAS: 1261498-41-2

• Purity: 95.0%
• Molecular weight: 177.12600708007812

3-(Difluoromethoxy)-2-fluoroaniline

CAS: 1261498-41-2

Versatile small molecule scaffold

• Formula: C₇H₆F₃NO
• Purity: Min. 95%
• Molecular weight: 177.12 g/mol