CAS 126150-99-0

4-Hydroxy-3-piperidinecarboxylic acid

Description:

4-Hydroxy-3-piperidinecarboxylic acid, also known as L-4-hydroxyproline, is an amino acid derivative characterized by its piperidine ring structure and a hydroxyl group attached to the fourth carbon. This compound is notable for its role in the biosynthesis of collagen and is often studied for its potential applications in pharmaceuticals and biochemistry. It exhibits both acidic and basic properties due to the presence of the carboxylic acid and amine functional groups, allowing it to participate in various chemical reactions, including peptide bond formation. The hydroxyl group contributes to its solubility in polar solvents, making it useful in biological systems. Additionally, 4-Hydroxy-3-piperidinecarboxylic acid can act as a chiral building block in organic synthesis, facilitating the creation of more complex molecules. Its CAS number, 126150-99-0, is a unique identifier that aids in the cataloging and regulation of this compound in chemical databases. Overall, this substance is significant in both natural processes and synthetic applications in chemistry.

Formula: C₆H₁₁NO₃

InChI: InChI=1S/C6H11NO3/c8-5-1-2-7-3-4(5)6(9)10/h4-5,7-8H,1-3H2,(H,9,10)

InChI key: InChIKey=DAMFVOCECLPLSI-UHFFFAOYSA-N

SMILES: C(O)(=O)C1C(O)CCNC1

Synonyms:

• 4-Hydroxy-3-piperidinecarboxylic acid
• 3-Piperidinecarboxylic acid, 4-hydroxy-