
CAS 1261500-75-7
:3-Hydroxy-2-(trifluoromethyl)benzenemethanol
Description:
3-Hydroxy-2-(trifluoromethyl)benzenemethanol, with the CAS number 1261500-75-7, is an organic compound characterized by the presence of a hydroxyl group (-OH) and a trifluoromethyl group (-CF3) attached to a benzene ring. This compound features a benzyl alcohol structure, where the hydroxyl group is directly bonded to a carbon atom that is also part of a phenyl ring. The trifluoromethyl group significantly influences the compound's chemical properties, enhancing its lipophilicity and potentially affecting its reactivity and biological activity. The presence of fluorine atoms can also impart unique characteristics such as increased stability and altered electronic properties. This compound may be of interest in various fields, including pharmaceuticals and agrochemicals, due to its potential applications in drug design and synthesis. Its solubility, melting point, and boiling point would depend on the specific molecular interactions and the presence of functional groups, making it essential to consider these factors in practical applications.
Formula:C8H7F3O2
InChI:InChI=1S/C8H7F3O2/c9-8(10,11)7-5(4-12)2-1-3-6(7)13/h1-3,12-13H,4H2
InChI key:InChIKey=UNEZQZUUESMJIG-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=C(CO)C=CC=C1O
Synonyms:- Benzenemethanol, 3-hydroxy-2-(trifluoromethyl)-
- 3-Hydroxy-2-(trifluoromethyl)benzenemethanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.