CymitQuimica logo

CAS 1261552-42-4

:

3-Bromo-5-(difluoromethoxy)phenol

Description:
3-Bromo-5-(difluoromethoxy)phenol is an organic compound characterized by the presence of a bromine atom and a difluoromethoxy group attached to a phenolic ring. The bromine substitution at the 3-position and the difluoromethoxy group at the 5-position contribute to its unique chemical properties, including potential reactivity and solubility characteristics. This compound is likely to exhibit moderate polarity due to the presence of the hydroxyl (-OH) group, which can engage in hydrogen bonding, enhancing its solubility in polar solvents. The difluoromethoxy group introduces additional electronegative fluorine atoms, which can influence the compound's electronic properties and reactivity. Such compounds may be of interest in various fields, including medicinal chemistry and materials science, due to their potential biological activity and utility in synthesizing more complex molecules. Safety data and handling precautions should be considered, as halogenated compounds can pose environmental and health risks.
Formula:C7H5BrF2O2
InChI:InChI=1S/C7H5BrF2O2/c8-4-1-5(11)3-6(2-4)12-7(9)10/h1-3,7,11H
InChI key:InChIKey=MDDCCEWPQJEAFR-UHFFFAOYSA-N
SMILES:O(C(F)F)C1=CC(Br)=CC(O)=C1
Synonyms:
  • Phenol, 3-bromo-5-(difluoromethoxy)-
  • 3-Bromo-5-(difluoromethoxy)phenol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.