CymitQuimica logo

CAS 1261552-65-1

:

1-Bromo-2-(difluoromethyl)-3-methoxybenzene

Description:
1-Bromo-2-(difluoromethyl)-3-methoxybenzene, with the CAS number 1261552-65-1, is an organic compound characterized by the presence of a bromine atom, a difluoromethyl group, and a methoxy group attached to a benzene ring. This compound features a substituted aromatic system, which contributes to its chemical reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The bromine atom serves as a good leaving group, making it useful in nucleophilic substitution reactions. The difluoromethyl group introduces unique electronic properties and can enhance lipophilicity, potentially influencing the compound's biological activity. The methoxy group, being an electron-donating group, can stabilize the aromatic ring and affect the compound's reactivity. Overall, the combination of these substituents results in a compound that may exhibit interesting chemical behavior and biological properties, making it a subject of interest in synthetic organic chemistry and medicinal chemistry research.
Formula:C8H7BrF2O
InChI:InChI=1S/C8H7BrF2O/c1-12-6-4-2-3-5(9)7(6)8(10)11/h2-4,8H,1H3
InChI key:InChIKey=MQJFOJHXQNXTAJ-UHFFFAOYSA-N
SMILES:C(F)(F)C1=C(OC)C=CC=C1Br
Synonyms:
  • Benzene, 1-bromo-2-(difluoromethyl)-3-methoxy-
  • 1-Bromo-2-(difluoromethyl)-3-methoxybenzene
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.