
CAS 1261557-71-4
:2-Chloro-α-hydroxy-3-methoxybenzeneacetic acid
Description:
2-Chloro-α-hydroxy-3-methoxybenzeneacetic acid, identified by its CAS number 1261557-71-4, is a chemical compound that features a benzene ring substituted with a chlorine atom, a methoxy group, and a carboxylic acid functional group. This compound is characterized by its potential as a pharmaceutical intermediate or in research applications due to its unique structural properties. The presence of the chloro and methoxy groups can influence its reactivity and solubility, making it of interest in various chemical syntheses. The α-hydroxy group suggests that it may exhibit properties related to alcohols, such as hydrogen bonding capabilities, which can affect its interactions in biological systems. Additionally, the carboxylic acid moiety contributes to its acidity and potential for forming salts or esters. Overall, this compound's specific characteristics, including its molecular weight, melting point, and solubility, would be essential for understanding its behavior in different chemical environments and applications.
Formula:C9H9ClO4
InChI:InChI=1S/C9H9ClO4/c1-14-6-4-2-3-5(7(6)10)8(11)9(12)13/h2-4,8,11H,1H3,(H,12,13)
InChI key:InChIKey=LJTLQAGXAHMFAB-UHFFFAOYSA-N
SMILES:C(C(O)=O)(O)C1=C(Cl)C(OC)=CC=C1
Synonyms:- 2-Chloro-α-hydroxy-3-methoxybenzeneacetic acid
- Benzeneacetic acid, 2-chloro-α-hydroxy-3-methoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.