CAS 1261576-82-2

6-Chloro-3-methyl-2(1H)-pyridinone

Description:

6-Chloro-3-methyl-2(1H)-pyridinone, identified by its CAS number 1261576-82-2, is a heterocyclic organic compound featuring a pyridinone structure. This compound is characterized by the presence of a chlorine atom at the 6-position and a methyl group at the 3-position of the pyridine ring. The pyridinone moiety contributes to its potential biological activity, as compounds of this class are often investigated for their pharmacological properties. Typically, such compounds exhibit moderate to high solubility in polar solvents due to the presence of the nitrogen and oxygen atoms in the ring, which can engage in hydrogen bonding. The chlorine substituent can influence the compound's reactivity and lipophilicity, potentially affecting its interaction with biological targets. Additionally, the compound may exhibit various functional properties, including antimicrobial or anti-inflammatory activities, making it of interest in medicinal chemistry. However, specific applications and safety profiles would require further investigation and empirical data.

Formula: C₆H₆ClNO

InChI: InChI=1S/C6H6ClNO/c1-4-2-3-5(7)8-6(4)9/h2-3H,1H3,(H,8,9)

InChI key: InChIKey=ZUOBGUJWZCQOCS-UHFFFAOYSA-N

SMILES: O=C1C(C)=CC=C(Cl)N1

Synonyms:

• 2(1H)-Pyridinone, 6-chloro-3-methyl-
• 6-Chloro-3-methyl-2(1H)-pyridinone

2(1H)-Pyridinone, 6-chloro-3-methyl-

CAS: 1261576-82-2

Formula: C₆H₆ClNO

Purity: 99%

Molecular weight: 143.5709

Ref: IN-DA000RUR

6-Chloro-3-methylpyridin-2(1H)-one

CAS: 1261576-82-2

Formula: C₆H₆ClNO

Purity: 95.0%

Color and Shape: Liquid, No data available.

Molecular weight: 143.57

Ref: 10-F243694