CAS 1261585-44-7
:Ethyl 2-bromo-5-cyanobenzoate
Description:
Ethyl 2-bromo-5-cyanobenzoate is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with both a bromine atom and a cyano group, along with an ethyl ester functional group. This compound typically appears as a solid or liquid, depending on its specific conditions, and is known for its moderate solubility in organic solvents. The presence of the bromine atom introduces notable reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. The cyano group contributes to the compound's polarity and can influence its reactivity and interactions with other molecules. Ethyl 2-bromo-5-cyanobenzoate is often utilized in synthetic organic chemistry, particularly in the development of pharmaceuticals and agrochemicals, due to its ability to serve as an intermediate in the synthesis of more complex structures. Safety precautions should be observed when handling this compound, as it may pose health risks associated with brominated and cyano-containing substances.
Formula:C10H8BrNO2
InChI:InChI=1S/C10H8BrNO2/c1-2-14-10(13)8-5-7(6-12)3-4-9(8)11/h3-5H,2H2,1H3
InChI key:InChIKey=LPZYUQDSUQFAOZ-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1=CC(C#N)=CC=C1Br
Synonyms:- Ethyl 2-bromo-5-cyanobenzoate
- Benzoic acid, 2-bromo-5-cyano-, ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
