CAS 1261588-73-1

3,3′-Bis(trifluoromethoxy)-1,1′-biphenyl

Description:

3,3′-Bis(trifluoromethoxy)-1,1′-biphenyl is an organic compound characterized by its biphenyl structure, where two phenyl rings are connected by a single bond. The compound features two trifluoromethoxy groups (-O-CF3) attached to the 3-position of each phenyl ring, which significantly influences its chemical properties. The presence of trifluoromethoxy groups enhances the compound's lipophilicity and thermal stability, making it potentially useful in various applications, including materials science and pharmaceuticals. This compound is likely to exhibit strong electron-withdrawing characteristics due to the highly electronegative fluorine atoms, which can affect its reactivity and interaction with other chemical species. Additionally, the trifluoromethoxy groups may impart unique optical properties, making it of interest in the development of advanced electronic materials. As with many fluorinated compounds, it may also exhibit low solubility in water but good solubility in organic solvents. Safety and handling precautions should be observed due to the potential toxicity associated with fluorinated organic compounds.

Formula: C₁₄H₈F₆O₂

InChI: InChI=1S/C14H8F6O2/c15-13(16,17)21-11-5-1-3-9(7-11)10-4-2-6-12(8-10)22-14(18,19)20/h1-8H

InChI key: InChIKey=YFTGRZXQPJKNIL-UHFFFAOYSA-N

SMILES: O(C(F)(F)F)C=1C=C(C=CC1)C2=CC(OC(F)(F)F)=CC=C2

Synonyms:

• 1,1′-Biphenyl, 3,3′-bis(trifluoromethoxy)-
• 3,3′-Bis(trifluoromethoxy)-1,1′-biphenyl

3,3'-Bis(trifluoromethoxy)-1,1'-biphenyl

CAS: 1261588-73-1

Formula: C₁₄H₈F₆O₂

Purity: >98.0%(GC)

Color and Shape: Colorless to Light yellow clear liquid

Molecular weight: 322.21

Ref: 3B-B6482