CAS 1261605-71-3

4′-Fluoro-2,3′-bis(trifluoromethyl)-1,1′-biphenyl

Description:

4′-Fluoro-2,3′-bis(trifluoromethyl)-1,1′-biphenyl is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a fluorine atom at the para position and two trifluoromethyl groups at the ortho positions significantly influences its chemical properties. This compound is typically non-polar due to the symmetrical arrangement of its substituents, which can lead to low solubility in polar solvents. Its trifluoromethyl groups contribute to high thermal stability and potential applications in materials science, particularly in the development of fluorinated polymers and pharmaceuticals. The fluorine substituents also enhance the compound's electron-withdrawing properties, which can affect its reactivity and interactions with other chemical species. Additionally, due to its unique structure, it may exhibit interesting electronic and optical properties, making it a subject of interest in research related to organic electronics and photonics. Safety data and handling precautions should be considered, as with any fluorinated compound, due to potential toxicity and environmental impact.

Formula: C₁₄H₇F₇

InChI: InChI=1S/C14H7F7/c15-12-6-5-8(7-11(12)14(19,20)21)9-3-1-2-4-10(9)13(16,17)18/h1-7H

InChI key: InChIKey=DOQFZAYBVLBOTG-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C1=C(C=CC=C1)C2=CC(C(F)(F)F)=C(F)C=C2

Synonyms:

• 1,1′-Biphenyl, 4′-fluoro-2,3′-bis(trifluoromethyl)-
• 4′-Fluoro-2,3′-bis(trifluoromethyl)-1,1′-biphenyl