
CAS 1261617-17-7
:1-Bromo-3-isocyanato-5-methoxybenzene
Description:
1-Bromo-3-isocyanato-5-methoxybenzene is an organic compound characterized by the presence of a bromine atom, an isocyanate functional group, and a methoxy substituent on a benzene ring. The molecular structure features a bromine atom at the 1-position, an isocyanate group (-N=C=O) at the 3-position, and a methoxy group (-OCH3) at the 5-position of the aromatic ring. This compound is likely to exhibit reactivity typical of both isocyanates and brominated compounds, making it useful in various synthetic applications, including the preparation of more complex organic molecules. The presence of the methoxy group may influence its solubility and reactivity, potentially enhancing its nucleophilicity or electrophilicity depending on the reaction conditions. Additionally, due to the isocyanate group, it may participate in reactions such as nucleophilic addition or polymerization. Safety precautions should be taken when handling this compound, as isocyanates are known to be toxic and can cause respiratory irritation.
Formula:C8H6BrNO2
InChI:InChI=1S/C8H6BrNO2/c1-12-8-3-6(9)2-7(4-8)10-5-11/h2-4H,1H3
InChI key:InChIKey=RFWVVACVDKPEJV-UHFFFAOYSA-N
SMILES:N(=C=O)C1=CC(OC)=CC(Br)=C1
Synonyms:- Benzene, 1-bromo-3-isocyanato-5-methoxy-
- 1-Bromo-3-isocyanato-5-methoxybenzene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.