
CAS 1261619-49-1
:Ethyl 3,5-dibromobenzenepropanoate
Description:
Ethyl 3,5-dibromobenzenepropanoate is an organic compound characterized by its ester functional group, which is derived from the reaction of a carboxylic acid and an alcohol. This compound features a propanoate moiety attached to a benzene ring that has two bromine substituents at the 3 and 5 positions, indicating its dibrominated structure. The presence of bromine atoms enhances the compound's reactivity and can influence its physical properties, such as solubility and boiling point. Ethyl 3,5-dibromobenzenepropanoate is likely to be a colorless to pale yellow liquid, exhibiting moderate volatility. It may be used in various chemical syntheses, particularly in the development of pharmaceuticals or agrochemicals, due to the reactivity of the bromine substituents. Safety considerations should be taken into account when handling this compound, as brominated compounds can be hazardous. Overall, its unique structure and functional groups make it a valuable compound in organic chemistry.
Formula:C11H12Br2O2
InChI:InChI=1S/C11H12Br2O2/c1-2-15-11(14)4-3-8-5-9(12)7-10(13)6-8/h5-7H,2-4H2,1H3
InChI key:InChIKey=HXCSTHNEOQOWEN-UHFFFAOYSA-N
SMILES:C(CC(OCC)=O)C1=CC(Br)=CC(Br)=C1
Synonyms:- Ethyl 3,5-dibromobenzenepropanoate
- Benzenepropanoic acid, 3,5-dibromo-, ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.