CAS 126163-02-8
:2,3-difluoro-4'-propylbiphenyl
Description:
2,3-Difluoro-4'-propylbiphenyl is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of two fluorine atoms at the 2 and 3 positions of one phenyl ring, along with a propyl group at the 4' position of the other ring, contributes to its unique chemical properties. This compound is typically a colorless to pale yellow liquid or solid, depending on temperature and purity. It exhibits moderate polarity due to the electronegative fluorine substituents, which can influence its solubility in various solvents. The fluorine atoms can also enhance the compound's thermal stability and alter its electronic properties, making it of interest in materials science and organic electronics. Additionally, the propyl group may affect its hydrophobicity and overall molecular interactions. As with many fluorinated compounds, 2,3-difluoro-4'-propylbiphenyl may have applications in the development of advanced materials, pharmaceuticals, or as a building block in organic synthesis.
Formula:C15H14F2
InChI:InChI=1/C15H14F2/c1-2-4-11-7-9-12(10-8-11)13-5-3-6-14(16)15(13)17/h3,5-10H,2,4H2,1H3
SMILES:CCCc1ccc(cc1)c1cccc(c1F)F
Synonyms:- 2,3-Difluoro-4'-propyl-1,1'-biphenyl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
