CymitQuimica logo

CAS 126163-36-8

:

1-Ethoxy-2,3-difluoro-4-(4-pentyl-1-cyclohexen-1-yl)benzene

Description:
1-Ethoxy-2,3-difluoro-4-(4-pentyl-1-cyclohexen-1-yl)benzene, with the CAS number 126163-36-8, is an organic compound characterized by its complex structure, which includes a benzene ring substituted with an ethoxy group, two fluorine atoms, and a cyclohexene moiety. The presence of the ethoxy group enhances its solubility in organic solvents, while the difluoro substitutions can influence its reactivity and polarity. The pentyl chain contributes to its hydrophobic characteristics, potentially affecting its interactions in biological systems or materials. This compound may exhibit interesting properties such as specific optical characteristics or reactivity patterns due to the combination of functional groups and substituents. Its unique structure suggests potential applications in fields such as organic synthesis, materials science, or pharmaceuticals, although specific applications would depend on further research into its properties and behavior in various environments. As with many fluorinated compounds, it may also exhibit distinct thermal and chemical stability, making it of interest in various chemical applications.
Formula:C19H26F2O
InChI:InChI=1S/C19H26F2O/c1-3-5-6-7-14-8-10-15(11-9-14)16-12-13-17(22-4-2)19(21)18(16)20/h10,12-14H,3-9,11H2,1-2H3
InChI key:InChIKey=PDEJZOMDRXWWNB-UHFFFAOYSA-N
SMILES:FC1=C(C=CC(OCC)=C1F)C=2CCC(CCCCC)CC2
Synonyms:
  • Benzene, 1-ethoxy-2,3-difluoro-4-(4-pentyl-1-cyclohexen-1-yl)-
  • 5LWO2
  • 1-Ethoxy-2,3-difluoro-4-(4-pentyl-1-cyclohexen-1-yl)benzene
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.