
CAS 1261646-25-6
:1-Chloro-2-(difluoromethyl)-3-methoxybenzene
Description:
1-Chloro-2-(difluoromethyl)-3-methoxybenzene, also known by its CAS number 1261646-25-6, is an organic compound characterized by the presence of a chloro group, a difluoromethyl group, and a methoxy group attached to a benzene ring. This compound features a chlorinated aromatic structure, which often contributes to its reactivity and potential applications in various chemical reactions. The difluoromethyl group introduces significant electronegativity, influencing the compound's polarity and reactivity. The methoxy group, being an electron-donating substituent, can enhance the nucleophilicity of the aromatic ring, making it more reactive towards electrophiles. This compound may exhibit interesting properties such as solubility in organic solvents and potential applications in pharmaceuticals or agrochemicals due to its unique functional groups. Additionally, its synthesis and handling require careful consideration of safety protocols due to the presence of halogenated components, which can pose environmental and health risks. Overall, 1-Chloro-2-(difluoromethyl)-3-methoxybenzene is a notable compound in organic chemistry with diverse implications.
Formula:C8H7ClF2O
InChI:InChI=1S/C8H7ClF2O/c1-12-6-4-2-3-5(9)7(6)8(10)11/h2-4,8H,1H3
InChI key:InChIKey=MFNWZWVLPNQZMZ-UHFFFAOYSA-N
SMILES:C(F)(F)C1=C(OC)C=CC=C1Cl
Synonyms:- 1-Chloro-2-(difluoromethyl)-3-methoxybenzene
- Benzene, 1-chloro-2-(difluoromethyl)-3-methoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.