
CAS 1261646-31-4
:2-Methoxy-6-nitrobenzenesulfonamide
Description:
2-Methoxy-6-nitrobenzenesulfonamide is an organic compound characterized by the presence of a methoxy group, a nitro group, and a sulfonamide functional group attached to a benzene ring. This compound typically exhibits a yellow to orange crystalline appearance and is soluble in polar solvents due to the presence of the sulfonamide group, which enhances its hydrophilicity. The nitro group contributes to its electron-withdrawing properties, influencing its reactivity and potential applications in organic synthesis. The sulfonamide moiety can participate in various chemical reactions, making this compound of interest in medicinal chemistry and material science. Additionally, the presence of the methoxy group can affect the compound's electronic properties and steric hindrance, which may play a role in its biological activity. Overall, 2-Methoxy-6-nitrobenzenesulfonamide is a versatile compound with potential applications in pharmaceuticals and agrochemicals, although specific biological activities and toxicological profiles would require further investigation.
Formula:C7H8N2O5S
InChI:InChI=1S/C7H8N2O5S/c1-14-6-4-2-3-5(9(10)11)7(6)15(8,12)13/h2-4H,1H3,(H2,8,12,13)
InChI key:InChIKey=XBJCOCHOLDKOLN-UHFFFAOYSA-N
SMILES:S(N)(=O)(=O)C1=C(N(=O)=O)C=CC=C1OC
Synonyms:- Benzenesulfonamide, 2-methoxy-6-nitro-
- 2-Methoxy-6-nitrobenzenesulfonamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.