CAS 1261647-85-1

5-Fluoro-2-iodobenzenesulfonamide

Description:

5-Fluoro-2-iodobenzenesulfonamide is an organic compound characterized by the presence of a sulfonamide functional group, a fluorine atom, and an iodine atom attached to a benzene ring. This compound features a sulfonamide moiety, which is known for its biological activity, particularly in pharmaceuticals, as it can exhibit antibacterial properties. The presence of the fluorine atom can enhance the lipophilicity and metabolic stability of the molecule, while the iodine atom may contribute to its reactivity and potential applications in medicinal chemistry. The compound is typically solid at room temperature and may be soluble in polar organic solvents. Its unique combination of halogen substituents can influence its electronic properties, making it a candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. Overall, 5-Fluoro-2-iodobenzenesulfonamide is of interest in the fields of organic synthesis and drug development, particularly for its potential use in creating novel therapeutic agents.

Formula: C₆H₅FINO₂S

InChI: InChI=1S/C6H5FINO2S/c7-4-1-2-5(8)6(3-4)12(9,10)11/h1-3H,(H2,9,10,11)

InChI key: InChIKey=TZWONXAFZZIWGZ-UHFFFAOYSA-N

SMILES: S(N)(=O)(=O)C1=C(I)C=CC(F)=C1

Synonyms:

• Benzenesulfonamide, 5-fluoro-2-iodo-
• 5-Fluoro-2-iodobenzenesulfonamide