CAS 1261649-13-1

3-Fluoro-2-hydroxybenzenesulfonyl chloride

Description:

3-Fluoro-2-hydroxybenzenesulfonyl chloride, identified by its CAS number 1261649-13-1, is a chemical compound characterized by the presence of a sulfonyl chloride functional group attached to a benzene ring that also features a hydroxyl group and a fluorine atom. This compound typically appears as a solid or liquid, depending on its purity and specific conditions. It is known for its reactivity, particularly due to the sulfonyl chloride moiety, which can participate in nucleophilic substitution reactions. The presence of the hydroxyl group can influence its solubility and reactivity, making it a useful intermediate in organic synthesis, particularly in the preparation of pharmaceuticals and agrochemicals. Additionally, the fluorine atom can enhance the compound's biological activity and stability. Safety precautions are essential when handling this substance, as it can be corrosive and may release toxic gases upon reaction with water or other nucleophiles. Proper storage and handling in a controlled environment are crucial to ensure safety and maintain the integrity of the compound.

Formula: C₆H₄ClFO₃S

InChI: InChI=1S/C6H4ClFO3S/c7-12(10,11)5-3-1-2-4(8)6(5)9/h1-3,9H

InChI key: InChIKey=XAMYNOWCRCTLPV-UHFFFAOYSA-N

SMILES: S(Cl)(=O)(=O)C1=C(O)C(F)=CC=C1

Synonyms:

• 3-Fluoro-2-hydroxybenzenesulfonyl chloride
• Benzenesulfonyl chloride, 3-fluoro-2-hydroxy-